C37H45N7O4 — CID 146117499
(3R)-3-[(1-benzyltriazol-4-yl)methyl]-18-(3-phenylpropyl)-12,15-dioxa-1,4,10,18-tetrazatricyclo[18.2.2.06,11]tetracosa-6(11),7,9-triene-2,5-dione (PubChem CID 146117499) has the molecular formula C37H45N7O4 and a molecular weight of 651.81 g/mol. Its IUPAC name is (3R)-3-[(1-benzyltriazol-4-yl)methyl]-18-(3-phenylpropyl)-12,15-dioxa-1,4,10,18-tetrazatricyclo[18.2.2.06,11]tetracosa-6(11),7,9-triene-2,5-dione.
| Compound Name | (3R)-3-[(1-benzyltriazol-4-yl)methyl]-18-(3-phenylpropyl)-12,15-dioxa-1,4,10,18-tetrazatricyclo[18.2.2.06,11]tetracosa-6(11),7,9-triene-2,5-dione |
|---|---|
| PubChem CID | 146117499 |
| Molecular Formula | C37H45N7O4 |
| Molecular Weight | 651.81 g/mol |
| Exact Mass | 651.35 |
| IUPAC Name | (3R)-3-[(1-benzyltriazol-4-yl)methyl]-18-(3-phenylpropyl)-12,15-dioxa-1,4,10,18-tetrazatricyclo[18.2.2.06,11]tetracosa-6(11),7,9-triene-2,5-dione |
| SMILES | O=C1N[C@H](Cc2cn(Cc3ccccc3)nn2)C(=O)N2CCC(CC2)CN(CCCc2ccccc2)CCOCCOc2ncccc21 |
| InChI | InChI=1S/C37H45N7O4/c45-35-33-14-7-17-38-36(33)48-24-23-47-22-21-42(18-8-13-29-9-3-1-4-10-29)26-31-15-19-43(20-16-31)37(46)34(39-35)25-32-28-44(41-40-32)27-30-11-5-2-6-12-30/h1-7,9-12,14,17,28,31,34H,8,13,15-16,18-27H2,(H,39,45)/t34-/m1/s1 |
| InChIKey | SOCUBAOTVAKLSH-UUWRZZSWSA-N |
| XLogP | 3.64 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.81 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|