C26H36N6O4 — CID 146117563
(3R)-3-propyl-18-(pyrimidin-5-ylmethyl)-12,15-dioxa-1,4,10,18-tetrazatricyclo[18.2.2.06,11]tetracosa-6(11),7,9-triene-2,5-dione (PubChem CID 146117563) has the molecular formula C26H36N6O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is (3R)-3-propyl-18-(pyrimidin-5-ylmethyl)-12,15-dioxa-1,4,10,18-tetrazatricyclo[18.2.2.06,11]tetracosa-6(11),7,9-triene-2,5-dione.
| Compound Name | (3R)-3-propyl-18-(pyrimidin-5-ylmethyl)-12,15-dioxa-1,4,10,18-tetrazatricyclo[18.2.2.06,11]tetracosa-6(11),7,9-triene-2,5-dione |
|---|---|
| PubChem CID | 146117563 |
| Molecular Formula | C26H36N6O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | (3R)-3-propyl-18-(pyrimidin-5-ylmethyl)-12,15-dioxa-1,4,10,18-tetrazatricyclo[18.2.2.06,11]tetracosa-6(11),7,9-triene-2,5-dione |
| SMILES | CCC[C@H]1NC(=O)c2cccnc2OCCOCCN(Cc2cncnc2)CC2CCN(CC2)C1=O |
| InChI | InChI=1S/C26H36N6O4/c1-2-4-23-26(34)32-9-6-20(7-10-32)17-31(18-21-15-27-19-28-16-21)11-12-35-13-14-36-25-22(24(33)30-23)5-3-8-29-25/h3,5,8,15-16,19-20,23H,2,4,6-7,9-14,17-18H2,1H3,(H,30,33)/t23-/m1/s1 |
| InChIKey | JYSQYMWNEFBGBZ-HSZRJFAPSA-N |
| XLogP | 1.92 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|