C30H45N5O6 — CID 146116380
N-benzyl-2-[(1R,6S,8S,22S)-3,9,18-trioxo-6-(propan-2-ylamino)-13,16-dioxa-4,10,19-triazatricyclo[17.3.1.04,8]tricosan-22-yl]acetamide (PubChem CID 146116380) has the molecular formula C30H45N5O6 and a molecular weight of 571.72 g/mol. Its IUPAC name is N-benzyl-2-[(1R,6S,8S,22S)-3,9,18-trioxo-6-(propan-2-ylamino)-13,16-dioxa-4,10,19-triazatricyclo[17.3.1.04,8]tricosan-22-yl]acetamide.
| Compound Name | N-benzyl-2-[(1R,6S,8S,22S)-3,9,18-trioxo-6-(propan-2-ylamino)-13,16-dioxa-4,10,19-triazatricyclo[17.3.1.04,8]tricosan-22-yl]acetamide |
|---|---|
| PubChem CID | 146116380 |
| Molecular Formula | C30H45N5O6 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.34 |
| IUPAC Name | N-benzyl-2-[(1R,6S,8S,22S)-3,9,18-trioxo-6-(propan-2-ylamino)-13,16-dioxa-4,10,19-triazatricyclo[17.3.1.04,8]tricosan-22-yl]acetamide |
| SMILES | CC(C)N[C@H]1C[C@H]2C(=O)NCCOCCOCC(=O)N3CC[C@@H](CC(=O)NCc4ccccc4)[C@@H](CC(=O)N2C1)C3 |
| InChI | InChI=1S/C30H45N5O6/c1-21(2)33-25-16-26-30(39)31-9-11-40-12-13-41-20-29(38)34-10-8-23(24(18-34)15-28(37)35(26)19-25)14-27(36)32-17-22-6-4-3-5-7-22/h3-7,21,23-26,33H,8-20H2,1-2H3,(H,31,39)(H,32,36)/t23-,24-,25-,26-/m0/s1 |
| InChIKey | JBXCRJRQJVVAEF-CQJMVLFOSA-N |
| XLogP | 0.68 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |