C27H39N5O7 — CID 146116339
N-[2-[(15S,17S)-17-(oxan-4-ylamino)-2,5,14-trioxo-7,10-dioxa-1,4,13-triazabicyclo[13.3.0]octadecan-4-yl]ethyl]benzamide (PubChem CID 146116339) has the molecular formula C27H39N5O7 and a molecular weight of 545.64 g/mol. Its IUPAC name is N-[2-[(15S,17S)-17-(oxan-4-ylamino)-2,5,14-trioxo-7,10-dioxa-1,4,13-triazabicyclo[13.3.0]octadecan-4-yl]ethyl]benzamide.
| Compound Name | N-[2-[(15S,17S)-17-(oxan-4-ylamino)-2,5,14-trioxo-7,10-dioxa-1,4,13-triazabicyclo[13.3.0]octadecan-4-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 146116339 |
| Molecular Formula | C27H39N5O7 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | N-[2-[(15S,17S)-17-(oxan-4-ylamino)-2,5,14-trioxo-7,10-dioxa-1,4,13-triazabicyclo[13.3.0]octadecan-4-yl]ethyl]benzamide |
| SMILES | O=C(NCCN1CC(=O)N2C[C@@H](NC3CCOCC3)C[C@H]2C(=O)NCCOCCOCC1=O)c1ccccc1 |
| InChI | InChI=1S/C27H39N5O7/c33-24-18-31(10-8-28-26(35)20-4-2-1-3-5-20)25(34)19-39-15-14-38-13-9-29-27(36)23-16-22(17-32(23)24)30-21-6-11-37-12-7-21/h1-5,21-23,30H,6-19H2,(H,28,35)(H,29,36)/t22-,23-/m0/s1 |
| InChIKey | SUVIWTPOPRPFOK-GOTSBHOMSA-N |
| XLogP | -0.85 |
| TPSA | 138.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |