C32H47N5O5 — CID 154814026
N-[4-[(4S,11S,13R)-13-(cyclopentylamino)-2,6,10-trioxospiro[1,5,9-triazabicyclo[9.4.0]pentadecane-7,4'-oxane]-4-yl]butyl]benzamide (PubChem CID 154814026) has the molecular formula C32H47N5O5 and a molecular weight of 581.76 g/mol. Its IUPAC name is N-[4-[(4S,11S,13R)-13-(cyclopentylamino)-2,6,10-trioxospiro[1,5,9-triazabicyclo[9.4.0]pentadecane-7,4'-oxane]-4-yl]butyl]benzamide.
| Compound Name | N-[4-[(4S,11S,13R)-13-(cyclopentylamino)-2,6,10-trioxospiro[1,5,9-triazabicyclo[9.4.0]pentadecane-7,4'-oxane]-4-yl]butyl]benzamide |
|---|---|
| PubChem CID | 154814026 |
| Molecular Formula | C32H47N5O5 |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.36 |
| IUPAC Name | N-[4-[(4S,11S,13R)-13-(cyclopentylamino)-2,6,10-trioxospiro[1,5,9-triazabicyclo[9.4.0]pentadecane-7,4'-oxane]-4-yl]butyl]benzamide |
| SMILES | O=C(NCCCC[C@H]1CC(=O)N2CC[C@@H](NC3CCCC3)C[C@H]2C(=O)NCC2(CCOCC2)C(=O)N1)c1ccccc1 |
| InChI | InChI=1S/C32H47N5O5/c38-28-21-25(12-6-7-16-33-29(39)23-8-2-1-3-9-23)36-31(41)32(14-18-42-19-15-32)22-34-30(40)27-20-26(13-17-37(27)28)35-24-10-4-5-11-24/h1-3,8-9,24-27,35H,4-7,10-22H2,(H,33,39)(H,34,40)(H,36,41)/t25-,26+,27-/m0/s1 |
| InChIKey | HYUFJPQZVGSZSM-VJGNERBWSA-N |
| XLogP | 2.28 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|