C12H15N3O3 — CID 110722595
N-[2-(3-oxomorpholin-4-yl)ethyl]pyridine-3-carboxamide (PubChem CID 110722595) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is N-[2-(3-oxomorpholin-4-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-(3-oxomorpholin-4-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110722595 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | N-[2-(3-oxomorpholin-4-yl)ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCN1CCOCC1=O)c1cccnc1 |
| InChI | InChI=1S/C12H15N3O3/c16-11-9-18-7-6-15(11)5-4-14-12(17)10-2-1-3-13-8-10/h1-3,8H,4-7,9H2,(H,14,17) |
| InChIKey | XJWPDTIJXQFPPI-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |