C17H22N4O4 — CID 14371868
N-[2-(2-methoxy-1,3-dioxo-2,8-diazaspiro[4.5]decan-8-yl)ethyl]pyridine-3-carboxamide (PubChem CID 14371868) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-[2-(2-methoxy-1,3-dioxo-2,8-diazaspiro[4.5]decan-8-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-(2-methoxy-1,3-dioxo-2,8-diazaspiro[4.5]decan-8-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 14371868 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-[2-(2-methoxy-1,3-dioxo-2,8-diazaspiro[4.5]decan-8-yl)ethyl]pyridine-3-carboxamide |
| SMILES | CON1C(=O)CC2(CCN(CCNC(=O)c3cccnc3)CC2)C1=O |
| InChI | InChI=1S/C17H22N4O4/c1-25-21-14(22)11-17(16(21)24)4-8-20(9-5-17)10-7-19-15(23)13-3-2-6-18-12-13/h2-3,6,12H,4-5,7-11H2,1H3,(H,19,23) |
| InChIKey | UAGTYHYKCQAHML-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|