C25H28N4O2 — CID 139793638
N-[2-[4-(2-phenylmethoxyphenyl)piperazin-1-yl]ethyl]pyridine-3-carboxamide (PubChem CID 139793638) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-[2-[4-(2-phenylmethoxyphenyl)piperazin-1-yl]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[4-(2-phenylmethoxyphenyl)piperazin-1-yl]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139793638 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[2-[4-(2-phenylmethoxyphenyl)piperazin-1-yl]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCN1CCN(c2ccccc2OCc2ccccc2)CC1)c1cccnc1 |
| InChI | InChI=1S/C25H28N4O2/c30-25(22-9-6-12-26-19-22)27-13-14-28-15-17-29(18-16-28)23-10-4-5-11-24(23)31-20-21-7-2-1-3-8-21/h1-12,19H,13-18,20H2,(H,27,30) |
| InChIKey | OACKGPIPWFPEOJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |