C28H34N4O2 — CID 42433151
N-[3-[3-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenoxy]propyl]pyridine-3-carboxamide (PubChem CID 42433151) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is N-[3-[3-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenoxy]propyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[3-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenoxy]propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 42433151 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | N-[3-[3-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]phenoxy]propyl]pyridine-3-carboxamide |
| SMILES | Cc1cccc(N2CCN(Cc3cccc(OCCCNC(=O)c4cccnc4)c3)CC2)c1C |
| InChI | InChI=1S/C28H34N4O2/c1-22-7-3-11-27(23(22)2)32-16-14-31(15-17-32)21-24-8-4-10-26(19-24)34-18-6-13-30-28(33)25-9-5-12-29-20-25/h3-5,7-12,19-20H,6,13-18,21H2,1-2H3,(H,30,33) |
| InChIKey | CKTICJRJJLTBRL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|