C25H26N4O3 — CID 143955756
N-[2-oxo-2-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]ethyl]pyridine-3-carboxamide (PubChem CID 143955756) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-[2-oxo-2-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-oxo-2-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 143955756 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-[2-oxo-2-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCC(=O)N1CCN(c2ccc(OCc3ccccc3)cc2)CC1)c1cccnc1 |
| InChI | InChI=1S/C25H26N4O3/c30-24(18-27-25(31)21-7-4-12-26-17-21)29-15-13-28(14-16-29)22-8-10-23(11-9-22)32-19-20-5-2-1-3-6-20/h1-12,17H,13-16,18-19H2,(H,27,31) |
| InChIKey | SCASAAKKEACQEV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|