C25H25BrN4O3 — CID 58462380
2-bromo-N-[2-oxo-2-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]ethyl]pyridine-4-carboxamide (PubChem CID 58462380) has the molecular formula C25H25BrN4O3 and a molecular weight of 509.40 g/mol. Its IUPAC name is 2-bromo-N-[2-oxo-2-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]ethyl]pyridine-4-carboxamide.
| Compound Name | 2-bromo-N-[2-oxo-2-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 58462380 |
| Molecular Formula | C25H25BrN4O3 |
| Molecular Weight | 509.40 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 2-bromo-N-[2-oxo-2-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]ethyl]pyridine-4-carboxamide |
| SMILES | O=C(NCC(=O)N1CCN(c2ccc(OCc3ccccc3)cc2)CC1)c1ccnc(Br)c1 |
| InChI | InChI=1S/C25H25BrN4O3/c26-23-16-20(10-11-27-23)25(32)28-17-24(31)30-14-12-29(13-15-30)21-6-8-22(9-7-21)33-18-19-4-2-1-3-5-19/h1-11,16H,12-15,17-18H2,(H,28,32) |
| InChIKey | TUBNINDCZUUZKV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|