C30H33N3O7 — CID 66886796
acetic acid;[3-[[2-oxo-2-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]ethyl]carbamoyl]phenyl] acetate (PubChem CID 66886796) has the molecular formula C30H33N3O7 and a molecular weight of 547.61 g/mol. Its IUPAC name is acetic acid;[3-[[2-oxo-2-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]ethyl]carbamoyl]phenyl] acetate.
| Compound Name | acetic acid;[3-[[2-oxo-2-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]ethyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 66886796 |
| Molecular Formula | C30H33N3O7 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | acetic acid;[3-[[2-oxo-2-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]ethyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)O.CC(=O)Oc1cccc(C(=O)NCC(=O)N2CCN(c3ccc(OCc4ccccc4)cc3)CC2)c1 |
| InChI | InChI=1S/C28H29N3O5.C2H4O2/c1-21(32)36-26-9-5-8-23(18-26)28(34)29-19-27(33)31-16-14-30(15-17-31)24-10-12-25(13-11-24)35-20-22-6-3-2-4-7-22;1-2(3)4/h2-13,18H,14-17,19-20H2,1H3,(H,29,34);1H3,(H,3,4) |
| InChIKey | VDWCRRAPNWVIRP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|