C30H28N4O3 — CID 166495125
4-phenylmethoxy-N-[4-[4-(pyridine-3-carbonyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 166495125) has the molecular formula C30H28N4O3 and a molecular weight of 492.58 g/mol. Its IUPAC name is 4-phenylmethoxy-N-[4-[4-(pyridine-3-carbonyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 4-phenylmethoxy-N-[4-[4-(pyridine-3-carbonyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 166495125 |
| Molecular Formula | C30H28N4O3 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 4-phenylmethoxy-N-[4-[4-(pyridine-3-carbonyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3cccnc3)CC2)cc1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H28N4O3/c35-29(24-8-14-28(15-9-24)37-22-23-5-2-1-3-6-23)32-26-10-12-27(13-11-26)33-17-19-34(20-18-33)30(36)25-7-4-16-31-21-25/h1-16,21H,17-20,22H2,(H,32,35) |
| InChIKey | RGQCCZIHFZCWQO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|