C23H23IN6O3 — CID 53378312
2-iodo-N-[2-oxo-2-[4-(5-phenylmethoxypyrimidin-2-yl)piperazin-1-yl]ethyl]pyridine-4-carboxamide (PubChem CID 53378312) has the molecular formula C23H23IN6O3 and a molecular weight of 558.38 g/mol. Its IUPAC name is 2-iodo-N-[2-oxo-2-[4-(5-phenylmethoxypyrimidin-2-yl)piperazin-1-yl]ethyl]pyridine-4-carboxamide.
| Compound Name | 2-iodo-N-[2-oxo-2-[4-(5-phenylmethoxypyrimidin-2-yl)piperazin-1-yl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 53378312 |
| Molecular Formula | C23H23IN6O3 |
| Molecular Weight | 558.38 g/mol |
| Exact Mass | 558.09 |
| IUPAC Name | 2-iodo-N-[2-oxo-2-[4-(5-phenylmethoxypyrimidin-2-yl)piperazin-1-yl]ethyl]pyridine-4-carboxamide |
| SMILES | O=C(NCC(=O)N1CCN(c2ncc(OCc3ccccc3)cn2)CC1)c1ccnc(I)c1 |
| InChI | InChI=1S/C23H23IN6O3/c24-20-12-18(6-7-25-20)22(32)26-15-21(31)29-8-10-30(11-9-29)23-27-13-19(14-28-23)33-16-17-4-2-1-3-5-17/h1-7,12-14H,8-11,15-16H2,(H,26,32) |
| InChIKey | BDGQNGIASDXOEN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|