C25H30N4O2S — CID 139793526
N-[4-[4-[2-(thiophen-2-ylmethoxy)phenyl]piperazin-1-yl]butyl]pyridine-3-carboxamide (PubChem CID 139793526) has the molecular formula C25H30N4O2S and a molecular weight of 450.61 g/mol. Its IUPAC name is N-[4-[4-[2-(thiophen-2-ylmethoxy)phenyl]piperazin-1-yl]butyl]pyridine-3-carboxamide.
| Compound Name | N-[4-[4-[2-(thiophen-2-ylmethoxy)phenyl]piperazin-1-yl]butyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139793526 |
| Molecular Formula | C25H30N4O2S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | N-[4-[4-[2-(thiophen-2-ylmethoxy)phenyl]piperazin-1-yl]butyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCCCN1CCN(c2ccccc2OCc2cccs2)CC1)c1cccnc1 |
| InChI | InChI=1S/C25H30N4O2S/c30-25(21-7-5-11-26-19-21)27-12-3-4-13-28-14-16-29(17-15-28)23-9-1-2-10-24(23)31-20-22-8-6-18-32-22/h1-2,5-11,18-19H,3-4,12-17,20H2,(H,27,30) |
| InChIKey | UDIWXZDBMSKCLT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|