C35H51F2N5O6 — CID 146116515
(16S,17R)-4-(1-benzoylpiperidin-4-yl)-17-[2-[(4,4-difluorocyclohexyl)amino]ethyl]-7,10-dioxa-1,4,13-triazabicyclo[14.2.2]icosane-2,5,14-trione (PubChem CID 146116515) has the molecular formula C35H51F2N5O6 and a molecular weight of 675.82 g/mol. Its IUPAC name is (16S,17R)-4-(1-benzoylpiperidin-4-yl)-17-[2-[(4,4-difluorocyclohexyl)amino]ethyl]-7,10-dioxa-1,4,13-triazabicyclo[14.2.2]icosane-2,5,14-trione.
| Compound Name | (16S,17R)-4-(1-benzoylpiperidin-4-yl)-17-[2-[(4,4-difluorocyclohexyl)amino]ethyl]-7,10-dioxa-1,4,13-triazabicyclo[14.2.2]icosane-2,5,14-trione |
|---|---|
| PubChem CID | 146116515 |
| Molecular Formula | C35H51F2N5O6 |
| Molecular Weight | 675.82 g/mol |
| Exact Mass | 675.38 |
| IUPAC Name | (16S,17R)-4-(1-benzoylpiperidin-4-yl)-17-[2-[(4,4-difluorocyclohexyl)amino]ethyl]-7,10-dioxa-1,4,13-triazabicyclo[14.2.2]icosane-2,5,14-trione |
| SMILES | O=C1C[C@@H]2CCN(C[C@@H]2CCNC2CCC(F)(F)CC2)C(=O)CN(C2CCN(C(=O)c3ccccc3)CC2)C(=O)COCCOCCN1 |
| InChI | InChI=1S/C35H51F2N5O6/c36-35(37)12-6-29(7-13-35)38-14-8-28-23-41-16-9-27(28)22-31(43)39-15-19-47-20-21-48-25-33(45)42(24-32(41)44)30-10-17-40(18-11-30)34(46)26-4-2-1-3-5-26/h1-5,27-30,38H,6-25H2,(H,39,43)/t27-,28-/m0/s1 |
| InChIKey | UMFWFZQSMVASMY-NSOVKSMOSA-N |
| XLogP | 2.70 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.82 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|