C23H31N3O4 — CID 134797290
4-[1-[1-(4-methylbenzoyl)piperidine-4-carbonyl]piperidin-4-yl]morpholin-3-one (PubChem CID 134797290) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is 4-[1-[1-(4-methylbenzoyl)piperidine-4-carbonyl]piperidin-4-yl]morpholin-3-one.
| Compound Name | 4-[1-[1-(4-methylbenzoyl)piperidine-4-carbonyl]piperidin-4-yl]morpholin-3-one |
|---|---|
| PubChem CID | 134797290 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 4-[1-[1-(4-methylbenzoyl)piperidine-4-carbonyl]piperidin-4-yl]morpholin-3-one |
| SMILES | Cc1ccc(C(=O)N2CCC(C(=O)N3CCC(N4CCOCC4=O)CC3)CC2)cc1 |
| InChI | InChI=1S/C23H31N3O4/c1-17-2-4-18(5-3-17)22(28)24-10-6-19(7-11-24)23(29)25-12-8-20(9-13-25)26-14-15-30-16-21(26)27/h2-5,19-20H,6-16H2,1H3 |
| InChIKey | TVGNIQMSDRICSV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |