C22H28FN3O4 — CID 134797710
4-[1-[1-(4-fluorobenzoyl)piperidine-4-carbonyl]piperidin-4-yl]morpholin-3-one (PubChem CID 134797710) has the molecular formula C22H28FN3O4 and a molecular weight of 417.48 g/mol. Its IUPAC name is 4-[1-[1-(4-fluorobenzoyl)piperidine-4-carbonyl]piperidin-4-yl]morpholin-3-one.
| Compound Name | 4-[1-[1-(4-fluorobenzoyl)piperidine-4-carbonyl]piperidin-4-yl]morpholin-3-one |
|---|---|
| PubChem CID | 134797710 |
| Molecular Formula | C22H28FN3O4 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 4-[1-[1-(4-fluorobenzoyl)piperidine-4-carbonyl]piperidin-4-yl]morpholin-3-one |
| SMILES | O=C(c1ccc(F)cc1)N1CCC(C(=O)N2CCC(N3CCOCC3=O)CC2)CC1 |
| InChI | InChI=1S/C22H28FN3O4/c23-18-3-1-16(2-4-18)21(28)24-9-5-17(6-10-24)22(29)25-11-7-19(8-12-25)26-13-14-30-15-20(26)27/h1-4,17,19H,5-15H2 |
| InChIKey | MERPHADEXZKPDM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |