C21H23NO2 — CID 2741000
[1-(4-methylbenzoyl)piperidin-4-yl]-(4-methylphenyl)methanone (PubChem CID 2741000) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is [1-(4-methylbenzoyl)piperidin-4-yl]-(4-methylphenyl)methanone.
| Compound Name | [1-(4-methylbenzoyl)piperidin-4-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 2741000 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | [1-(4-methylbenzoyl)piperidin-4-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)C2CCN(C(=O)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H23NO2/c1-15-3-7-17(8-4-15)20(23)18-11-13-22(14-12-18)21(24)19-9-5-16(2)6-10-19/h3-10,18H,11-14H2,1-2H3 |
| InChIKey | ZASCHQPPNGSAKO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |