C24H24FN3O4 — CID 134495102
5-(fluoromethyl)-5-[4-[4-(4-methylbenzoyl)piperidine-1-carbonyl]phenyl]imidazolidine-2,4-dione (PubChem CID 134495102) has the molecular formula C24H24FN3O4 and a molecular weight of 437.47 g/mol. Its IUPAC name is 5-(fluoromethyl)-5-[4-[4-(4-methylbenzoyl)piperidine-1-carbonyl]phenyl]imidazolidine-2,4-dione.
| Compound Name | 5-(fluoromethyl)-5-[4-[4-(4-methylbenzoyl)piperidine-1-carbonyl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 134495102 |
| Molecular Formula | C24H24FN3O4 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 5-(fluoromethyl)-5-[4-[4-(4-methylbenzoyl)piperidine-1-carbonyl]phenyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(C(=O)C2CCN(C(=O)c3ccc(C4(CF)NC(=O)NC4=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H24FN3O4/c1-15-2-4-16(5-3-15)20(29)17-10-12-28(13-11-17)21(30)18-6-8-19(9-7-18)24(14-25)22(31)26-23(32)27-24/h2-9,17H,10-14H2,1H3,(H2,26,27,31,32) |
| InChIKey | NWEGJFFPLJBEBF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|