C22H24FN5O3 — CID 134494613
5-[4-[3-[(3,5-dimethyl-2-pyridinyl)amino]pyrrolidine-1-carbonyl]phenyl]-5-(fluoromethyl)imidazolidine-2,4-dione (PubChem CID 134494613) has the molecular formula C22H24FN5O3 and a molecular weight of 425.46 g/mol. Its IUPAC name is 5-[4-[3-[(3,5-dimethyl-2-pyridinyl)amino]pyrrolidine-1-carbonyl]phenyl]-5-(fluoromethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[4-[3-[(3,5-dimethyl-2-pyridinyl)amino]pyrrolidine-1-carbonyl]phenyl]-5-(fluoromethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 134494613 |
| Molecular Formula | C22H24FN5O3 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 5-[4-[3-[(3,5-dimethyl-2-pyridinyl)amino]pyrrolidine-1-carbonyl]phenyl]-5-(fluoromethyl)imidazolidine-2,4-dione |
| SMILES | Cc1cnc(NC2CCN(C(=O)c3ccc(C4(CF)NC(=O)NC4=O)cc3)C2)c(C)c1 |
| InChI | InChI=1S/C22H24FN5O3/c1-13-9-14(2)18(24-10-13)25-17-7-8-28(11-17)19(29)15-3-5-16(6-4-15)22(12-23)20(30)26-21(31)27-22/h3-6,9-10,17H,7-8,11-12H2,1-2H3,(H,24,25)(H2,26,27,30,31) |
| InChIKey | IITUAMLSRQTAFG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|