C22H25N5O3 — CID 134495091
(5R)-5-[4-[(3S)-3-[(3,5-dimethyl-2-pyridinyl)amino]pyrrolidine-1-carbonyl]phenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 134495091) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is (5R)-5-[4-[(3S)-3-[(3,5-dimethyl-2-pyridinyl)amino]pyrrolidine-1-carbonyl]phenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-[4-[(3S)-3-[(3,5-dimethyl-2-pyridinyl)amino]pyrrolidine-1-carbonyl]phenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 134495091 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | (5R)-5-[4-[(3S)-3-[(3,5-dimethyl-2-pyridinyl)amino]pyrrolidine-1-carbonyl]phenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | Cc1cnc(N[C@H]2CCN(C(=O)c3ccc([C@@]4(C)NC(=O)NC4=O)cc3)C2)c(C)c1 |
| InChI | InChI=1S/C22H25N5O3/c1-13-10-14(2)18(23-11-13)24-17-8-9-27(12-17)19(28)15-4-6-16(7-5-15)22(3)20(29)25-21(30)26-22/h4-7,10-11,17H,8-9,12H2,1-3H3,(H,23,24)(H2,25,26,29,30)/t17-,22+/m0/s1 |
| InChIKey | MLYLZSROAUWQRD-HTAPYJJXSA-N |
| XLogP | 2.08 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|