C17H21N3O4 — CID 127758807
5-[4-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]phenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 127758807) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 5-[4-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]phenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[4-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]phenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 127758807 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 5-[4-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]phenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@@H]1CN(C(=O)c2ccc(C3(C)NC(=O)NC3=O)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C17H21N3O4/c1-10-8-20(9-11(2)24-10)14(21)12-4-6-13(7-5-12)17(3)15(22)18-16(23)19-17/h4-7,10-11H,8-9H2,1-3H3,(H2,18,19,22,23)/t10-,11+,17? |
| InChIKey | GXKCAYBKZZNWOK-DNJLBHFNSA-N |
| XLogP | 0.99 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|