C29H50N6O4 — CID 154813593
(1S,6R,11S,18R)-20-(3,3-dimethylbutanoyl)-14-methyl-8-(1-methylpiperidin-4-yl)-3,8,14,17,20-pentazatricyclo[16.2.1.06,11]henicosane-2,13,16-trione (PubChem CID 154813593) has the molecular formula C29H50N6O4 and a molecular weight of 546.76 g/mol. Its IUPAC name is (1S,6R,11S,18R)-20-(3,3-dimethylbutanoyl)-14-methyl-8-(1-methylpiperidin-4-yl)-3,8,14,17,20-pentazatricyclo[16.2.1.06,11]henicosane-2,13,16-trione.
| Compound Name | (1S,6R,11S,18R)-20-(3,3-dimethylbutanoyl)-14-methyl-8-(1-methylpiperidin-4-yl)-3,8,14,17,20-pentazatricyclo[16.2.1.06,11]henicosane-2,13,16-trione |
|---|---|
| PubChem CID | 154813593 |
| Molecular Formula | C29H50N6O4 |
| Molecular Weight | 546.76 g/mol |
| Exact Mass | 546.39 |
| IUPAC Name | (1S,6R,11S,18R)-20-(3,3-dimethylbutanoyl)-14-methyl-8-(1-methylpiperidin-4-yl)-3,8,14,17,20-pentazatricyclo[16.2.1.06,11]henicosane-2,13,16-trione |
| SMILES | CN1CCC(N2CC[C@H]3CC(=O)N(C)CC(=O)N[C@@H]4C[C@@H](C(=O)NCC[C@H]3C2)N(C(=O)CC(C)(C)C)C4)CC1 |
| InChI | InChI=1S/C29H50N6O4/c1-29(2,3)16-27(38)35-18-22-15-24(35)28(39)30-10-6-21-17-34(23-8-11-32(4)12-9-23)13-7-20(21)14-26(37)33(5)19-25(36)31-22/h20-24H,6-19H2,1-5H3,(H,30,39)(H,31,36)/t20-,21-,22+,24-/m0/s1 |
| InChIKey | CUXYONFRQBHSMZ-YCSHWKNNSA-N |
| XLogP | 0.91 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.76 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |