About 1-(1-methylpiperidin-4-yl)-1,4-diazepan-5-one
1-(1-methylpiperidin-4-yl)-1,4-diazepan-5-one (PubChem CID 70902475) has the molecular formula C11H21N3O
and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-(1-methylpiperidin-4-yl)-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 1-(1-methylpiperidin-4-yl)-1,4-diazepan-5-one |
| PubChem CID | 70902475 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1-(1-methylpiperidin-4-yl)-1,4-diazepan-5-one |
| SMILES | CN1CCC(N2CCNC(=O)CC2)CC1 |
| InChI | InChI=1S/C11H21N3O/c1-13-6-2-10(3-7-13)14-8-4-11(15)12-5-9-14/h10H,2-9H2,1H3,(H,12,15) |
| InChIKey | XBVBGCCRNQEQGY-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1-methylpiperidin-4-yl)-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methylpiperidin-4-yl)-1,4-diazepan-5-one?
The IUPAC name of 1-(1-methylpiperidin-4-yl)-1,4-diazepan-5-one (CID 70902475) is 1-(1-methylpiperidin-4-yl)-1,4-diazepan-5-one.
What is the SMILES notation for 1-(1-methylpiperidin-4-yl)-1,4-diazepan-5-one?
The canonical SMILES for 1-(1-methylpiperidin-4-yl)-1,4-diazepan-5-one is CN1CCC(N2CCNC(=O)CC2)CC1.
What is the InChIKey of 1-(1-methylpiperidin-4-yl)-1,4-diazepan-5-one?
The InChIKey is XBVBGCCRNQEQGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O/c1-13-6-2-10(3-7-13)14-8-4-11(15)12-5-9-14/h10H,2-9H2,1H3,(H,12,15).
What are the key properties of 1-(1-methylpiperidin-4-yl)-1,4-diazepan-5-one?
1-(1-methylpiperidin-4-yl)-1,4-diazepan-5-one has a molecular weight of 211.31 g/mol, XLogP of -0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methylpiperidin-4-yl)-1,4-diazepan-5-one is sourced from PubChem (CID 70902475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).