About 8-hydroxy-1-methyl-1,4-diazecan-5-one
8-hydroxy-1-methyl-1,4-diazecan-5-one (PubChem CID 123855637) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is 8-hydroxy-1-methyl-1,4-diazecan-5-one.
Molecular Properties
| Compound Name | 8-hydroxy-1-methyl-1,4-diazecan-5-one |
| PubChem CID | 123855637 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 8-hydroxy-1-methyl-1,4-diazecan-5-one |
| SMILES | CN1CCNC(=O)CCC(O)CC1 |
| InChI | InChI=1S/C9H18N2O2/c1-11-6-4-8(12)2-3-9(13)10-5-7-11/h8,12H,2-7H2,1H3,(H,10,13) |
| InChIKey | UPLRHLJOOMBFFR-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-hydroxy-1-methyl-1,4-diazecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-1-methyl-1,4-diazecan-5-one?
The IUPAC name of 8-hydroxy-1-methyl-1,4-diazecan-5-one (CID 123855637) is 8-hydroxy-1-methyl-1,4-diazecan-5-one.
What is the SMILES notation for 8-hydroxy-1-methyl-1,4-diazecan-5-one?
The canonical SMILES for 8-hydroxy-1-methyl-1,4-diazecan-5-one is CN1CCNC(=O)CCC(O)CC1.
What is the InChIKey of 8-hydroxy-1-methyl-1,4-diazecan-5-one?
The InChIKey is UPLRHLJOOMBFFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-11-6-4-8(12)2-3-9(13)10-5-7-11/h8,12H,2-7H2,1H3,(H,10,13).
What are the key properties of 8-hydroxy-1-methyl-1,4-diazecan-5-one?
8-hydroxy-1-methyl-1,4-diazecan-5-one has a molecular weight of 186.25 g/mol, XLogP of -0.42, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-1-methyl-1,4-diazecan-5-one is sourced from PubChem (CID 123855637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).