C14H19N3O — CID 79741363
1-(5-amino-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one (PubChem CID 79741363) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 1-(5-amino-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one.
| Compound Name | 1-(5-amino-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 79741363 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 1-(5-amino-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one |
| SMILES | Nc1ccc2c(c1)CCC2N1CCNC(=O)CC1 |
| InChI | InChI=1S/C14H19N3O/c15-11-2-3-12-10(9-11)1-4-13(12)17-7-5-14(18)16-6-8-17/h2-3,9,13H,1,4-8,15H2,(H,16,18) |
| InChIKey | CFPGTBUFEDVDIE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|