C18H26N2 — CID 79721711
1-(2-azaspiro[3.6]decan-2-yl)-2,3-dihydro-1H-inden-5-amine (PubChem CID 79721711) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-(2-azaspiro[3.6]decan-2-yl)-2,3-dihydro-1H-inden-5-amine.
| Compound Name | 1-(2-azaspiro[3.6]decan-2-yl)-2,3-dihydro-1H-inden-5-amine |
|---|---|
| PubChem CID | 79721711 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 1-(2-azaspiro[3.6]decan-2-yl)-2,3-dihydro-1H-inden-5-amine |
| SMILES | Nc1ccc2c(c1)CCC2N1CC2(CCCCCC2)C1 |
| InChI | InChI=1S/C18H26N2/c19-15-6-7-16-14(11-15)5-8-17(16)20-12-18(13-20)9-3-1-2-4-10-18/h6-7,11,17H,1-5,8-10,12-13,19H2 |
| InChIKey | JBXNZCSRKZIXSS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|