C15H21N3O — CID 102887555
4-(5-amino-2,3-dihydro-1H-inden-1-yl)-1-methyl-1,4-diazepan-2-one (PubChem CID 102887555) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-(5-amino-2,3-dihydro-1H-inden-1-yl)-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(5-amino-2,3-dihydro-1H-inden-1-yl)-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102887555 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 4-(5-amino-2,3-dihydro-1H-inden-1-yl)-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(C2CCc3cc(N)ccc32)CC1=O |
| InChI | InChI=1S/C15H21N3O/c1-17-7-2-8-18(10-15(17)19)14-6-3-11-9-12(16)4-5-13(11)14/h4-5,9,14H,2-3,6-8,10,16H2,1H3 |
| InChIKey | NYOGMHHFZZPBLK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|