C16H20N2O2 — CID 116650629
1-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-4-methylpiperidine-2,6-dione (PubChem CID 116650629) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 1-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-4-methylpiperidine-2,6-dione.
| Compound Name | 1-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-4-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 116650629 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-(6-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-4-methylpiperidine-2,6-dione |
| SMILES | CC1CC(=O)N(C2CCCc3cc(N)ccc32)C(=O)C1 |
| InChI | InChI=1S/C16H20N2O2/c1-10-7-15(19)18(16(20)8-10)14-4-2-3-11-9-12(17)5-6-13(11)14/h5-6,9-10,14H,2-4,7-8,17H2,1H3 |
| InChIKey | UOPJGEALOATRJC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|