C16H28N4O2 — CID 166117554
3-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]amino]piperidine-2,6-dione (PubChem CID 166117554) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 3-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166117554 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 3-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]amino]piperidine-2,6-dione |
| SMILES | CN1CCC(N2CCC(NC3CCC(=O)NC3=O)CC2)CC1 |
| InChI | InChI=1S/C16H28N4O2/c1-19-8-6-13(7-9-19)20-10-4-12(5-11-20)17-14-2-3-15(21)18-16(14)22/h12-14,17H,2-11H2,1H3,(H,18,21,22) |
| InChIKey | JWQHZULFXNNTSL-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|