C6H11IN2O — CID 166797027
1-iodo-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-amine (PubChem CID 166797027) has the molecular formula C6H11IN2O and a molecular weight of 254.07 g/mol. Its IUPAC name is 1-iodo-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-amine.
| Compound Name | 1-iodo-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-amine |
|---|---|
| PubChem CID | 166797027 |
| Molecular Formula | C6H11IN2O |
| Molecular Weight | 254.07 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 1-iodo-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-amine |
| SMILES | NC1CN(I)C2COCC12 |
| InChI | InChI=1S/C6H11IN2O/c7-9-1-5(8)4-2-10-3-6(4)9/h4-6H,1-3,8H2 |
| InChIKey | LQHGTSDVZHQWHE-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.07 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|