C7H12INO — CID 139403608
1-iodo-2-methyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole (PubChem CID 139403608) has the molecular formula C7H12INO and a molecular weight of 253.08 g/mol. Its IUPAC name is 1-iodo-2-methyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole.
| Compound Name | 1-iodo-2-methyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole |
|---|---|
| PubChem CID | 139403608 |
| Molecular Formula | C7H12INO |
| Molecular Weight | 253.08 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 1-iodo-2-methyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole |
| SMILES | CC1CC2COCC2N1I |
| InChI | InChI=1S/C7H12INO/c1-5-2-6-3-10-4-7(6)9(5)8/h5-7H,2-4H2,1H3 |
| InChIKey | WCYYEWOZQVTCJX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.08 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|