C10H16N2O4 — CID 68807402
(2S,3aR,6aS)-2-(dimethylcarbamoyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxylic acid (PubChem CID 68807402) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is (2S,3aR,6aS)-2-(dimethylcarbamoyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxylic acid.
| Compound Name | (2S,3aR,6aS)-2-(dimethylcarbamoyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxylic acid |
|---|---|
| PubChem CID | 68807402 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (2S,3aR,6aS)-2-(dimethylcarbamoyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxylic acid |
| SMILES | CN(C)C(=O)[C@@H]1C[C@H]2COC[C@H]2N1C(=O)O |
| InChI | InChI=1S/C10H16N2O4/c1-11(2)9(13)7-3-6-4-16-5-8(6)12(7)10(14)15/h6-8H,3-5H2,1-2H3,(H,14,15)/t6-,7-,8+/m0/s1 |
| InChIKey | CGXWGKMESCHWBG-BIIVOSGPSA-N |
| XLogP | -0.16 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |