C22H30N2O6 — CID 67852621
1-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-2-carboxylic acid (PubChem CID 67852621) has the molecular formula C22H30N2O6 and a molecular weight of 418.49 g/mol. Its IUPAC name is 1-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-2-carboxylic acid.
| Compound Name | 1-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 67852621 |
| Molecular Formula | C22H30N2O6 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 1-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-2-carboxylic acid |
| SMILES | CCOC(=O)C(CCc1ccccc1)N[C@@H](C)C(=O)N1C(C(=O)O)CC2COCC21 |
| InChI | InChI=1S/C22H30N2O6/c1-3-30-22(28)17(10-9-15-7-5-4-6-8-15)23-14(2)20(25)24-18(21(26)27)11-16-12-29-13-19(16)24/h4-8,14,16-19,23H,3,9-13H2,1-2H3,(H,26,27)/t14-,16?,17?,18?,19?/m0/s1 |
| InChIKey | DHFHQURKYJFDGJ-DHBQWTBNSA-N |
| XLogP | 1.23 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |