C20H26N2O6 — CID 86748148
ethyl (2S)-1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-2-carboxylate (PubChem CID 86748148) has the molecular formula C20H26N2O6 and a molecular weight of 390.44 g/mol. Its IUPAC name is ethyl (2S)-1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-2-carboxylate.
| Compound Name | ethyl (2S)-1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 86748148 |
| Molecular Formula | C20H26N2O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | ethyl (2S)-1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC2COCC2N1C(=O)[C@H](C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H26N2O6/c1-3-27-19(24)16-9-15-11-26-12-17(15)22(16)18(23)13(2)21-20(25)28-10-14-7-5-4-6-8-14/h4-8,13,15-17H,3,9-12H2,1-2H3,(H,21,25)/t13-,15?,16-,17?/m0/s1 |
| InChIKey | AVDVVHHPTYXYON-PXZKZTPFSA-N |
| XLogP | 1.48 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |