C10H21NO — CID 144826290
(2R,3aR,6aS)-1,2-dimethyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;ethane (PubChem CID 144826290) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is (2R,3aR,6aS)-1,2-dimethyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;ethane.
| Compound Name | (2R,3aR,6aS)-1,2-dimethyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;ethane |
|---|---|
| PubChem CID | 144826290 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (2R,3aR,6aS)-1,2-dimethyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;ethane |
| SMILES | CC.C[C@@H]1C[C@H]2COC[C@H]2N1C |
| InChI | InChI=1S/C8H15NO.C2H6/c1-6-3-7-4-10-5-8(7)9(6)2;1-2/h6-8H,3-5H2,1-2H3;1-2H3/t6-,7+,8-;/m1./s1 |
| InChIKey | GCFPUDUEZFCZOB-ARIDFIBWSA-N |
| XLogP | 1.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |