C9H22O2 — CID 166485181
(3S,4R)-3,4-dimethyloxolane;ethane;methanol (PubChem CID 166485181) has the molecular formula C9H22O2 and a molecular weight of 162.27 g/mol. Its IUPAC name is (3S,4R)-3,4-dimethyloxolane;ethane;methanol.
| Compound Name | (3S,4R)-3,4-dimethyloxolane;ethane;methanol |
|---|---|
| PubChem CID | 166485181 |
| Molecular Formula | C9H22O2 |
| Molecular Weight | 162.27 g/mol |
| Exact Mass | 162.16 |
| IUPAC Name | (3S,4R)-3,4-dimethyloxolane;ethane;methanol |
| SMILES | CC.CO.C[C@@H]1COC[C@@H]1C |
| InChI | InChI=1S/C6H12O.C2H6.CH4O/c1-5-3-7-4-6(5)2;2*1-2/h5-6H,3-4H2,1-2H3;1-2H3;2H,1H3/t5-,6+;; |
| InChIKey | OYIUBNOXQREEPT-RUTFAPCESA-N |
| XLogP | 1.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |