C8H16O — CID 145261700
(3R)-3,4-dimethyloxolane;ethene (PubChem CID 145261700) has the molecular formula C8H16O and a molecular weight of 128.22 g/mol. Its IUPAC name is (3R)-3,4-dimethyloxolane;ethene.
| Compound Name | (3R)-3,4-dimethyloxolane;ethene |
|---|---|
| PubChem CID | 145261700 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | (3R)-3,4-dimethyloxolane;ethene |
| SMILES | C=C.CC1COC[C@@H]1C |
| InChI | InChI=1S/C6H12O.C2H4/c1-5-3-7-4-6(5)2;1-2/h5-6H,3-4H2,1-2H3;1-2H2/t5-,6?;/m0./s1 |
| InChIKey | QDASRKDEYWIMKR-GNVLWMSISA-N |
| XLogP | 2.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|