About (3R)-3,4-dimethyloxolane;ethene
(3R)-3,4-dimethyloxolane;ethene (PubChem CID 145261700) has the molecular formula C8H16O
and a molecular weight of 128.22 g/mol. Its IUPAC name is (3R)-3,4-dimethyloxolane;ethene.
Molecular Properties
| Compound Name | (3R)-3,4-dimethyloxolane;ethene |
| PubChem CID | 145261700 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | (3R)-3,4-dimethyloxolane;ethene |
| SMILES | C=C.CC1COC[C@@H]1C |
| InChI | InChI=1S/C6H12O.C2H4/c1-5-3-7-4-6(5)2;1-2/h5-6H,3-4H2,1-2H3;1-2H2/t5-,6?;/m0./s1 |
| InChIKey | QDASRKDEYWIMKR-GNVLWMSISA-N |
| XLogP | 2.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3,4-dimethyloxolane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3,4-dimethyloxolane;ethene?
The IUPAC name of (3R)-3,4-dimethyloxolane;ethene (CID 145261700) is (3R)-3,4-dimethyloxolane;ethene.
What is the SMILES notation for (3R)-3,4-dimethyloxolane;ethene?
The canonical SMILES for (3R)-3,4-dimethyloxolane;ethene is C=C.CC1COC[C@@H]1C.
What is the InChIKey of (3R)-3,4-dimethyloxolane;ethene?
The InChIKey is QDASRKDEYWIMKR-GNVLWMSISA-N. The full InChI is InChI=1S/C6H12O.C2H4/c1-5-3-7-4-6(5)2;1-2/h5-6H,3-4H2,1-2H3;1-2H2/t5-,6?;/m0./s1.
What are the key properties of (3R)-3,4-dimethyloxolane;ethene?
(3R)-3,4-dimethyloxolane;ethene has a molecular weight of 128.22 g/mol, XLogP of 2.09, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3,4-dimethyloxolane;ethene is sourced from PubChem (CID 145261700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).