C6H12ClNO — CID 14340350
4-chloro-3,5-dimethylmorpholine (PubChem CID 14340350) has the molecular formula C6H12ClNO and a molecular weight of 149.62 g/mol. Its IUPAC name is 4-chloro-3,5-dimethylmorpholine.
| Compound Name | 4-chloro-3,5-dimethylmorpholine |
|---|---|
| PubChem CID | 14340350 |
| Molecular Formula | C6H12ClNO |
| Molecular Weight | 149.62 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 4-chloro-3,5-dimethylmorpholine |
| SMILES | CC1COCC(C)N1Cl |
| InChI | InChI=1S/C6H12ClNO/c1-5-3-9-4-6(2)8(5)7/h5-6H,3-4H2,1-2H3 |
| InChIKey | NLAWBYUWYSXTSU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.62 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|