C15H24ClN5O2 — CID 139505234
(3S,5S)-4-[4-chloro-6-[(3S,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]-3,5-dimethylmorpholine (PubChem CID 139505234) has the molecular formula C15H24ClN5O2 and a molecular weight of 341.84 g/mol. Its IUPAC name is (3S,5S)-4-[4-chloro-6-[(3S,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]-3,5-dimethylmorpholine.
| Compound Name | (3S,5S)-4-[4-chloro-6-[(3S,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]-3,5-dimethylmorpholine |
|---|---|
| PubChem CID | 139505234 |
| Molecular Formula | C15H24ClN5O2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | (3S,5S)-4-[4-chloro-6-[(3S,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]-3,5-dimethylmorpholine |
| SMILES | C[C@H]1COC[C@H](C)N1c1nc(Cl)nc(N2[C@@H](C)COC[C@@H]2C)n1 |
| InChI | InChI=1S/C15H24ClN5O2/c1-9-5-22-6-10(2)20(9)14-17-13(16)18-15(19-14)21-11(3)7-23-8-12(21)4/h9-12H,5-8H2,1-4H3/t9-,10-,11-,12-/m0/s1 |
| InChIKey | RMZUFERQSOOUPJ-BJDJZHNGSA-N |
| XLogP | 1.75 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |