C16H28IN — CID 170151734
2-iodo-2-azatricyclo[8.6.1.04,17]heptadecane (PubChem CID 170151734) has the molecular formula C16H28IN and a molecular weight of 361.31 g/mol. Its IUPAC name is 2-iodo-2-azatricyclo[8.6.1.04,17]heptadecane.
| Compound Name | 2-iodo-2-azatricyclo[8.6.1.04,17]heptadecane |
|---|---|
| PubChem CID | 170151734 |
| Molecular Formula | C16H28IN |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-iodo-2-azatricyclo[8.6.1.04,17]heptadecane |
| SMILES | IN1CC2CCCCCC3CCCCCCC1C32 |
| InChI | InChI=1S/C16H28IN/c17-18-12-14-10-6-3-5-9-13-8-4-1-2-7-11-15(18)16(13)14/h13-16H,1-12H2 |
| InChIKey | CAOQGIWZPXYHSG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|