About 12-iodo-12-azatricyclo[11.8.0.02,11]henicosane
12-iodo-12-azatricyclo[11.8.0.02,11]henicosane (PubChem CID 134476762) has the molecular formula C20H36IN
and a molecular weight of 417.42 g/mol. Its IUPAC name is 12-iodo-12-azatricyclo[11.8.0.02,11]henicosane.
Molecular Properties
| Compound Name | 12-iodo-12-azatricyclo[11.8.0.02,11]henicosane |
| PubChem CID | 134476762 |
| Molecular Formula | C20H36IN |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 12-iodo-12-azatricyclo[11.8.0.02,11]henicosane |
| SMILES | IN1C2CCCCCCCCC2C2CCCCCCCCC21 |
| InChI | InChI=1S/C20H36IN/c21-22-19-15-11-7-3-1-5-9-13-17(19)18-14-10-6-2-4-8-12-16-20(18)22/h17-20H,1-16H2 |
| InChIKey | MMBCHQPIUNLZJX-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 12-iodo-12-azatricyclo[11.8.0.02,11]henicosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-iodo-12-azatricyclo[11.8.0.02,11]henicosane?
The IUPAC name of 12-iodo-12-azatricyclo[11.8.0.02,11]henicosane (CID 134476762) is 12-iodo-12-azatricyclo[11.8.0.02,11]henicosane.
What is the SMILES notation for 12-iodo-12-azatricyclo[11.8.0.02,11]henicosane?
The canonical SMILES for 12-iodo-12-azatricyclo[11.8.0.02,11]henicosane is IN1C2CCCCCCCCC2C2CCCCCCCCC21.
What is the InChIKey of 12-iodo-12-azatricyclo[11.8.0.02,11]henicosane?
The InChIKey is MMBCHQPIUNLZJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36IN/c21-22-19-15-11-7-3-1-5-9-13-17(19)18-14-10-6-2-4-8-12-16-20(18)22/h17-20H,1-16H2.
What are the key properties of 12-iodo-12-azatricyclo[11.8.0.02,11]henicosane?
12-iodo-12-azatricyclo[11.8.0.02,11]henicosane has a molecular weight of 417.42 g/mol, XLogP of 6.89, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 12-iodo-12-azatricyclo[11.8.0.02,11]henicosane is sourced from PubChem (CID 134476762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).