C10H18IN — CID 170152209
2-iodo-1,3,3a,4,5,6,7,8,9,9a-decahydrocycloocta[c]pyrrole (PubChem CID 170152209) has the molecular formula C10H18IN and a molecular weight of 279.17 g/mol. Its IUPAC name is 2-iodo-1,3,3a,4,5,6,7,8,9,9a-decahydrocycloocta[c]pyrrole.
| Compound Name | 2-iodo-1,3,3a,4,5,6,7,8,9,9a-decahydrocycloocta[c]pyrrole |
|---|---|
| PubChem CID | 170152209 |
| Molecular Formula | C10H18IN |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-iodo-1,3,3a,4,5,6,7,8,9,9a-decahydrocycloocta[c]pyrrole |
| SMILES | IN1CC2CCCCCCC2C1 |
| InChI | InChI=1S/C10H18IN/c11-12-7-9-5-3-1-2-4-6-10(9)8-12/h9-10H,1-8H2 |
| InChIKey | YWTMJBFOLXRXNC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|