C20H37N — CID 155380713
2-methyl-2-azatricyclo[11.7.0.03,9]icosane (PubChem CID 155380713) has the molecular formula C20H37N and a molecular weight of 291.52 g/mol. Its IUPAC name is 2-methyl-2-azatricyclo[11.7.0.03,9]icosane.
| Compound Name | 2-methyl-2-azatricyclo[11.7.0.03,9]icosane |
|---|---|
| PubChem CID | 155380713 |
| Molecular Formula | C20H37N |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 291.29 |
| IUPAC Name | 2-methyl-2-azatricyclo[11.7.0.03,9]icosane |
| SMILES | CN1C2CCCCCCCC2CCCC2CCCCCC21 |
| InChI | InChI=1S/C20H37N/c1-21-19-15-8-4-2-3-6-11-17(19)13-10-14-18-12-7-5-9-16-20(18)21/h17-20H,2-16H2,1H3 |
| InChIKey | FAESJLSXWYPHPX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |