C13H23N — CID 163972586
(3R,12S)-2,12-dimethyl-2-azatricyclo[5.4.1.03,5]dodecane (PubChem CID 163972586) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (3R,12S)-2,12-dimethyl-2-azatricyclo[5.4.1.03,5]dodecane.
| Compound Name | (3R,12S)-2,12-dimethyl-2-azatricyclo[5.4.1.03,5]dodecane |
|---|---|
| PubChem CID | 163972586 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (3R,12S)-2,12-dimethyl-2-azatricyclo[5.4.1.03,5]dodecane |
| SMILES | C[C@H]1C2CCCCC1N(C)[C@@H]1CC1C2 |
| InChI | InChI=1S/C13H23N/c1-9-10-5-3-4-6-12(9)14(2)13-8-11(13)7-10/h9-13H,3-8H2,1-2H3/t9-,10?,11?,12?,13+/m0/s1 |
| InChIKey | SRHLDZVJPHGAIS-CDEGIIQSSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |