C5H10FIN2 — CID 155111181
(3S,5S)-3-fluoro-5-iodopiperidin-1-amine (PubChem CID 155111181) has the molecular formula C5H10FIN2 and a molecular weight of 244.05 g/mol. Its IUPAC name is (3S,5S)-3-fluoro-5-iodopiperidin-1-amine.
| Compound Name | (3S,5S)-3-fluoro-5-iodopiperidin-1-amine |
|---|---|
| PubChem CID | 155111181 |
| Molecular Formula | C5H10FIN2 |
| Molecular Weight | 244.05 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | (3S,5S)-3-fluoro-5-iodopiperidin-1-amine |
| SMILES | NN1C[C@@H](F)C[C@H](I)C1 |
| InChI | InChI=1S/C5H10FIN2/c6-4-1-5(7)3-9(8)2-4/h4-5H,1-3,8H2/t4-,5-/m0/s1 |
| InChIKey | TYXPEZIEVYAOPT-WHFBIAKZSA-N |
| XLogP | 0.71 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.05 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|