C8H15F2N — CID 176851982
(3S,5R)-3,5-difluoro-1-propan-2-ylpiperidine (PubChem CID 176851982) has the molecular formula C8H15F2N and a molecular weight of 163.21 g/mol. Its IUPAC name is (3S,5R)-3,5-difluoro-1-propan-2-ylpiperidine.
| Compound Name | (3S,5R)-3,5-difluoro-1-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 176851982 |
| Molecular Formula | C8H15F2N |
| Molecular Weight | 163.21 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | (3S,5R)-3,5-difluoro-1-propan-2-ylpiperidine |
| SMILES | CC(C)N1C[C@H](F)C[C@H](F)C1 |
| InChI | InChI=1S/C8H15F2N/c1-6(2)11-4-7(9)3-8(10)5-11/h6-8H,3-5H2,1-2H3/t7-,8+ |
| InChIKey | GAWFDRDBOOBBOB-OCAPTIKFSA-N |
| XLogP | 1.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |