About [(4R,5S)-4,5-difluoro-1-propan-2-ylpiperidin-3-yl]silane
[(4R,5S)-4,5-difluoro-1-propan-2-ylpiperidin-3-yl]silane (PubChem CID 174073343) has the molecular formula C8H17F2NSi
and a molecular weight of 193.31 g/mol. Its IUPAC name is [(4R,5S)-4,5-difluoro-1-propan-2-ylpiperidin-3-yl]silane.
Molecular Properties
| Compound Name | [(4R,5S)-4,5-difluoro-1-propan-2-ylpiperidin-3-yl]silane |
| PubChem CID | 174073343 |
| Molecular Formula | C8H17F2NSi |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | [(4R,5S)-4,5-difluoro-1-propan-2-ylpiperidin-3-yl]silane |
| SMILES | CC(C)N1CC([SiH3])[C@H](F)[C@@H](F)C1 |
| InChI | InChI=1S/C8H17F2NSi/c1-5(2)11-3-6(9)8(10)7(12)4-11/h5-8H,3-4H2,1-2,12H3/t6-,7?,8+/m0/s1 |
| InChIKey | CBWMXOWXPAJFTH-YPVSKDHRSA-N |
| XLogP | 0.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(4R,5S)-4,5-difluoro-1-propan-2-ylpiperidin-3-yl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R,5S)-4,5-difluoro-1-propan-2-ylpiperidin-3-yl]silane?
The IUPAC name of [(4R,5S)-4,5-difluoro-1-propan-2-ylpiperidin-3-yl]silane (CID 174073343) is [(4R,5S)-4,5-difluoro-1-propan-2-ylpiperidin-3-yl]silane.
What is the SMILES notation for [(4R,5S)-4,5-difluoro-1-propan-2-ylpiperidin-3-yl]silane?
The canonical SMILES for [(4R,5S)-4,5-difluoro-1-propan-2-ylpiperidin-3-yl]silane is CC(C)N1CC([SiH3])[C@H](F)[C@@H](F)C1.
What is the InChIKey of [(4R,5S)-4,5-difluoro-1-propan-2-ylpiperidin-3-yl]silane?
The InChIKey is CBWMXOWXPAJFTH-YPVSKDHRSA-N. The full InChI is InChI=1S/C8H17F2NSi/c1-5(2)11-3-6(9)8(10)7(12)4-11/h5-8H,3-4H2,1-2,12H3/t6-,7?,8+/m0/s1.
What are the key properties of [(4R,5S)-4,5-difluoro-1-propan-2-ylpiperidin-3-yl]silane?
[(4R,5S)-4,5-difluoro-1-propan-2-ylpiperidin-3-yl]silane has a molecular weight of 193.31 g/mol, XLogP of 0.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R,5S)-4,5-difluoro-1-propan-2-ylpiperidin-3-yl]silane is sourced from PubChem (CID 174073343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).