C6H12N2S — CID 134356880
5-sulfanyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 134356880) has the molecular formula C6H12N2S and a molecular weight of 144.24 g/mol. Its IUPAC name is 5-sulfanyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-sulfanyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 134356880 |
| Molecular Formula | C6H12N2S |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 5-sulfanyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | SN1CC2CNCC2C1 |
| InChI | InChI=1S/C6H12N2S/c9-8-3-5-1-7-2-6(5)4-8/h5-7,9H,1-4H2 |
| InChIKey | LMJGYMNDCMDNRI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|